C20H19F3N2O8S — CID 20613388
2-(hydroxycarbamoyl)-3-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylbenzoic acid (PubChem CID 20613388) has the molecular formula C20H19F3N2O8S and a molecular weight of 504.44 g/mol. Its IUPAC name is 2-(hydroxycarbamoyl)-3-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 2-(hydroxycarbamoyl)-3-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 20613388 |
| Molecular Formula | C20H19F3N2O8S |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 2-(hydroxycarbamoyl)-3-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylbenzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)N2CCC(Oc3ccc(OC(F)(F)F)cc3)CC2)c1C(=O)NO |
| InChI | InChI=1S/C20H19F3N2O8S/c21-20(22,23)33-14-6-4-12(5-7-14)32-13-8-10-25(11-9-13)34(30,31)16-3-1-2-15(19(27)28)17(16)18(26)24-29/h1-7,13,29H,8-11H2,(H,24,26)(H,27,28) |
| InChIKey | MAWNMGCLWDYFJP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|