C19H25F3N2O6S — CID 142009576
N-hydroxy-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylcyclohexane-1-carboxamide (PubChem CID 142009576) has the molecular formula C19H25F3N2O6S and a molecular weight of 466.48 g/mol. Its IUPAC name is N-hydroxy-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylcyclohexane-1-carboxamide.
| Compound Name | N-hydroxy-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 142009576 |
| Molecular Formula | C19H25F3N2O6S |
| Molecular Weight | 466.48 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | N-hydroxy-1-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylcyclohexane-1-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(Oc3ccc(OC(F)(F)F)cc3)CC2)CCCCC1 |
| InChI | InChI=1S/C19H25F3N2O6S/c20-19(21,22)30-16-6-4-14(5-7-16)29-15-8-12-24(13-9-15)31(27,28)18(17(25)23-26)10-2-1-3-11-18/h4-7,15,26H,1-3,8-13H2,(H,23,25) |
| InChIKey | AQLQTWGMLGHJSS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|