C21H33N3O6S — CID 59989399
N-hydroxy-1-(2-methoxyethyl)-4-[4-(4-methylphenoxy)piperidin-1-yl]sulfonylpiperidine-4-carboxamide (PubChem CID 59989399) has the molecular formula C21H33N3O6S and a molecular weight of 455.58 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-[4-(4-methylphenoxy)piperidin-1-yl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-(4-methylphenoxy)piperidin-1-yl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 59989399 |
| Molecular Formula | C21H33N3O6S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-(4-methylphenoxy)piperidin-1-yl]sulfonylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)N2CCC(Oc3ccc(C)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H33N3O6S/c1-17-3-5-18(6-4-17)30-19-7-11-24(12-8-19)31(27,28)21(20(25)22-26)9-13-23(14-10-21)15-16-29-2/h3-6,19,26H,7-16H2,1-2H3,(H,22,25) |
| InChIKey | KJIZNGYJFDJPDS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|