C22H26F3N5O5S — CID 22052587
N-hydroxy-1-pyrimidin-2-yl-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidine-4-carboxamide (PubChem CID 22052587) has the molecular formula C22H26F3N5O5S and a molecular weight of 529.54 g/mol. Its IUPAC name is N-hydroxy-1-pyrimidin-2-yl-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-pyrimidin-2-yl-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 22052587 |
| Molecular Formula | C22H26F3N5O5S |
| Molecular Weight | 529.54 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | N-hydroxy-1-pyrimidin-2-yl-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCC(Oc3ccc(C(F)(F)F)cc3)CC2)CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C22H26F3N5O5S/c23-22(24,25)16-2-4-17(5-3-16)35-18-6-12-30(13-7-18)36(33,34)21(19(31)28-32)8-14-29(15-9-21)20-26-10-1-11-27-20/h1-5,10-11,18,32H,6-9,12-15H2,(H,28,31) |
| InChIKey | SDZSMKJRAOZCHI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|