C24H37N5O5S — CID 21068797
4-[4-[4-(4-cyanobutyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 21068797) has the molecular formula C24H37N5O5S and a molecular weight of 507.66 g/mol. Its IUPAC name is 4-[4-[4-(4-cyanobutyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | 4-[4-[4-(4-cyanobutyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 21068797 |
| Molecular Formula | C24H37N5O5S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 4-[4-[4-(4-cyanobutyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)N2CCN(c3ccc(CCCCC#N)cc3)CC2)CC1 |
| InChI | InChI=1S/C24H37N5O5S/c1-34-20-19-27-13-10-24(11-14-27,23(30)26-31)35(32,33)29-17-15-28(16-18-29)22-8-6-21(7-9-22)5-3-2-4-12-25/h6-9,31H,2-5,10-11,13-20H2,1H3,(H,26,30) |
| InChIKey | OSGFEYXXOAJKSG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|