C26H42N4O5S — CID 21068902
4-[4-[4-(cyclohexylmethyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide (PubChem CID 21068902) has the molecular formula C26H42N4O5S and a molecular weight of 522.71 g/mol. Its IUPAC name is 4-[4-[4-(cyclohexylmethyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide.
| Compound Name | 4-[4-[4-(cyclohexylmethyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 21068902 |
| Molecular Formula | C26H42N4O5S |
| Molecular Weight | 522.71 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 4-[4-[4-(cyclohexylmethyl)phenyl]piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide |
| SMILES | COCCN1CCC(C(=O)NO)(S(=O)(=O)N2CCN(c3ccc(CC4CCCCC4)cc3)CC2)CC1 |
| InChI | InChI=1S/C26H42N4O5S/c1-35-20-19-28-13-11-26(12-14-28,25(31)27-32)36(33,34)30-17-15-29(16-18-30)24-9-7-23(8-10-24)21-22-5-3-2-4-6-22/h7-10,22,32H,2-6,11-21H2,1H3,(H,27,31) |
| InChIKey | JZLFVAWTHGCPNT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.71 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|