C22H37Cl2FN4O6S — CID 162334316
4-[4-(3-fluoro-4-propoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide;dihydrochloride (PubChem CID 162334316) has the molecular formula C22H37Cl2FN4O6S and a molecular weight of 575.53 g/mol. Its IUPAC name is 4-[4-(3-fluoro-4-propoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide;dihydrochloride.
| Compound Name | 4-[4-(3-fluoro-4-propoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 162334316 |
| Molecular Formula | C22H37Cl2FN4O6S |
| Molecular Weight | 575.53 g/mol |
| Exact Mass | 574.18 |
| IUPAC Name | 4-[4-(3-fluoro-4-propoxyphenyl)piperazin-1-yl]sulfonyl-N-hydroxy-1-(2-methoxyethyl)piperidine-4-carboxamide;dihydrochloride |
| SMILES | CCCOc1ccc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCN(CCOC)CC3)CC2)cc1F.Cl.Cl |
| InChI | InChI=1S/C22H35FN4O6S.2ClH/c1-3-15-33-20-5-4-18(17-19(20)23)26-10-12-27(13-11-26)34(30,31)22(21(28)24-29)6-8-25(9-7-22)14-16-32-2;;/h4-5,17,29H,3,6-16H2,1-2H3,(H,24,28);2*1H |
| InChIKey | OSCOKMMOALDUNN-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|