C20H28FN3O6S — CID 21068900
4-[4-(4-cyclobutyloxy-3-fluorophenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 21068900) has the molecular formula C20H28FN3O6S and a molecular weight of 457.52 g/mol. Its IUPAC name is 4-[4-(4-cyclobutyloxy-3-fluorophenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-(4-cyclobutyloxy-3-fluorophenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 21068900 |
| Molecular Formula | C20H28FN3O6S |
| Molecular Weight | 457.52 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 4-[4-(4-cyclobutyloxy-3-fluorophenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCN(c3ccc(OC4CCC4)c(F)c3)CC2)CCOCC1 |
| InChI | InChI=1S/C20H28FN3O6S/c21-17-14-15(4-5-18(17)30-16-2-1-3-16)23-8-10-24(11-9-23)31(27,28)20(19(25)22-26)6-12-29-13-7-20/h4-5,14,16,26H,1-3,6-13H2,(H,22,25) |
| InChIKey | PQUTUXLRJQUXCR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.52 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|