C22H26FN3O5S — CID 21068741
4-[4-(3-fluoro-4-phenylphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide (PubChem CID 21068741) has the molecular formula C22H26FN3O5S and a molecular weight of 463.53 g/mol. Its IUPAC name is 4-[4-(3-fluoro-4-phenylphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide.
| Compound Name | 4-[4-(3-fluoro-4-phenylphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide |
|---|---|
| PubChem CID | 21068741 |
| Molecular Formula | C22H26FN3O5S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 4-[4-(3-fluoro-4-phenylphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCN(c3ccc(-c4ccccc4)c(F)c3)CC2)CCOCC1 |
| InChI | InChI=1S/C22H26FN3O5S/c23-20-16-18(6-7-19(20)17-4-2-1-3-5-17)25-10-12-26(13-11-25)32(29,30)22(21(27)24-28)8-14-31-15-9-22/h1-7,16,28H,8-15H2,(H,24,27) |
| InChIKey | URTSNNYEYYZUHZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|