C20H28ClF4N3O6S — CID 162313353
4-[4-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride (PubChem CID 162313353) has the molecular formula C20H28ClF4N3O6S and a molecular weight of 549.97 g/mol. Its IUPAC name is 4-[4-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride.
| Compound Name | 4-[4-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162313353 |
| Molecular Formula | C20H28ClF4N3O6S |
| Molecular Weight | 549.97 g/mol |
| Exact Mass | 549.13 |
| IUPAC Name | 4-[4-[2-fluoro-4-(4,4,4-trifluorobutoxy)phenyl]piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)C1(S(=O)(=O)N2CCN(c3ccc(OCCCC(F)(F)F)cc3F)CC2)CCOCC1 |
| InChI | InChI=1S/C20H27F4N3O6S.ClH/c21-16-14-15(33-11-1-4-20(22,23)24)2-3-17(16)26-7-9-27(10-8-26)34(30,31)19(18(28)25-29)5-12-32-13-6-19;/h2-3,14,29H,1,4-13H2,(H,25,28);1H |
| InChIKey | XGXSEAKLUWVBPQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.97 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|