C19H26F3N3O6S — CID 21068751
N-hydroxy-4-[4-[4-(2,2,2-trifluoroethoxymethyl)phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 21068751) has the molecular formula C19H26F3N3O6S and a molecular weight of 481.49 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-(2,2,2-trifluoroethoxymethyl)phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[4-(2,2,2-trifluoroethoxymethyl)phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 21068751 |
| Molecular Formula | C19H26F3N3O6S |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.15 |
| IUPAC Name | N-hydroxy-4-[4-[4-(2,2,2-trifluoroethoxymethyl)phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | O=C(NO)C1(S(=O)(=O)N2CCN(c3ccc(COCC(F)(F)F)cc3)CC2)CCOCC1 |
| InChI | InChI=1S/C19H26F3N3O6S/c20-19(21,22)14-31-13-15-1-3-16(4-2-15)24-7-9-25(10-8-24)32(28,29)18(17(26)23-27)5-11-30-12-6-18/h1-4,27H,5-14H2,(H,23,26) |
| InChIKey | JDEUFEJMIULTDC-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|