C20H31N3O6S — CID 21068925
N-hydroxy-4-[4-(3-methyl-4-propan-2-yloxyphenyl)piperazin-1-yl]sulfonyloxane-4-carboxamide (PubChem CID 21068925) has the molecular formula C20H31N3O6S and a molecular weight of 441.55 g/mol. Its IUPAC name is N-hydroxy-4-[4-(3-methyl-4-propan-2-yloxyphenyl)piperazin-1-yl]sulfonyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-(3-methyl-4-propan-2-yloxyphenyl)piperazin-1-yl]sulfonyloxane-4-carboxamide |
|---|---|
| PubChem CID | 21068925 |
| Molecular Formula | C20H31N3O6S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | N-hydroxy-4-[4-(3-methyl-4-propan-2-yloxyphenyl)piperazin-1-yl]sulfonyloxane-4-carboxamide |
| SMILES | Cc1cc(N2CCN(S(=O)(=O)C3(C(=O)NO)CCOCC3)CC2)ccc1OC(C)C |
| InChI | InChI=1S/C20H31N3O6S/c1-15(2)29-18-5-4-17(14-16(18)3)22-8-10-23(11-9-22)30(26,27)20(19(24)21-25)6-12-28-13-7-20/h4-5,14-15,25H,6-13H2,1-3H3,(H,21,24) |
| InChIKey | MIJGEIDOUKXINV-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|