C20H25ClFN3O5S2 — CID 162329905
4-[4-(3-fluoro-4-thiophen-2-ylphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride (PubChem CID 162329905) has the molecular formula C20H25ClFN3O5S2 and a molecular weight of 506.02 g/mol. Its IUPAC name is 4-[4-(3-fluoro-4-thiophen-2-ylphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride.
| Compound Name | 4-[4-(3-fluoro-4-thiophen-2-ylphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162329905 |
| Molecular Formula | C20H25ClFN3O5S2 |
| Molecular Weight | 506.02 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 4-[4-(3-fluoro-4-thiophen-2-ylphenyl)piperazin-1-yl]sulfonyl-N-hydroxyoxane-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)C1(S(=O)(=O)N2CCN(c3ccc(-c4cccs4)c(F)c3)CC2)CCOCC1 |
| InChI | InChI=1S/C20H24FN3O5S2.ClH/c21-17-14-15(3-4-16(17)18-2-1-13-30-18)23-7-9-24(10-8-23)31(27,28)20(19(25)22-26)5-11-29-12-6-20;/h1-4,13-14,26H,5-12H2,(H,22,25);1H |
| InChIKey | LANAFGOFXZYUHC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.02 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|