C23H27ClF3N3O6S — CID 162312650
N-hydroxy-4-[4-[4-[4-(trifluoromethoxy)phenyl]phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride (PubChem CID 162312650) has the molecular formula C23H27ClF3N3O6S and a molecular weight of 566.00 g/mol. Its IUPAC name is N-hydroxy-4-[4-[4-[4-(trifluoromethoxy)phenyl]phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-4-[4-[4-[4-(trifluoromethoxy)phenyl]phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 162312650 |
| Molecular Formula | C23H27ClF3N3O6S |
| Molecular Weight | 566.00 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | N-hydroxy-4-[4-[4-[4-(trifluoromethoxy)phenyl]phenyl]piperazin-1-yl]sulfonyloxane-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)C1(S(=O)(=O)N2CCN(c3ccc(-c4ccc(OC(F)(F)F)cc4)cc3)CC2)CCOCC1 |
| InChI | InChI=1S/C23H26F3N3O6S.ClH/c24-23(25,26)35-20-7-3-18(4-8-20)17-1-5-19(6-2-17)28-11-13-29(14-12-28)36(32,33)22(21(30)27-31)9-15-34-16-10-22;/h1-8,31H,9-16H2,(H,27,30);1H |
| InChIKey | MLHLYGGQRYXGRK-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 108.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.00 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|