C26H33F3N4O5S — CID 142952217
1-benzyl-N-hydroxy-4-[methyl-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]oxysulfanylamino]piperidine-4-carboxamide (PubChem CID 142952217) has the molecular formula C26H33F3N4O5S and a molecular weight of 570.63 g/mol. Its IUPAC name is 1-benzyl-N-hydroxy-4-[methyl-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]oxysulfanylamino]piperidine-4-carboxamide.
| Compound Name | 1-benzyl-N-hydroxy-4-[methyl-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]oxysulfanylamino]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 142952217 |
| Molecular Formula | C26H33F3N4O5S |
| Molecular Weight | 570.63 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 1-benzyl-N-hydroxy-4-[methyl-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]oxysulfanylamino]piperidine-4-carboxamide |
| SMILES | CN(SON1CCC(Oc2ccc(OC(F)(F)F)cc2)CC1)C1(C(=O)NO)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H33F3N4O5S/c1-31(25(24(34)30-35)13-17-32(18-14-25)19-20-5-3-2-4-6-20)39-38-33-15-11-22(12-16-33)36-21-7-9-23(10-8-21)37-26(27,28)29/h2-10,22,35H,11-19H2,1H3,(H,30,34) |
| InChIKey | BMIYTWTXBPMSDU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 86.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|