C19H19F3N2O3 — CID 53235333
(1-benzylpyrrolidin-3-yl) N-[4-(trifluoromethoxy)phenyl]carbamate (PubChem CID 53235333) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is (1-benzylpyrrolidin-3-yl) N-[4-(trifluoromethoxy)phenyl]carbamate.
| Compound Name | (1-benzylpyrrolidin-3-yl) N-[4-(trifluoromethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 53235333 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (1-benzylpyrrolidin-3-yl) N-[4-(trifluoromethoxy)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)OC1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C19H19F3N2O3/c20-19(21,22)27-16-8-6-15(7-9-16)23-18(25)26-17-10-11-24(13-17)12-14-4-2-1-3-5-14/h1-9,17H,10-13H2,(H,23,25) |
| InChIKey | BZATXUBOKHAANF-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |