C13H15F3N2O3 — CID 115565230
piperidin-3-yl N-[4-(trifluoromethoxy)phenyl]carbamate (PubChem CID 115565230) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is piperidin-3-yl N-[4-(trifluoromethoxy)phenyl]carbamate.
| Compound Name | piperidin-3-yl N-[4-(trifluoromethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 115565230 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | piperidin-3-yl N-[4-(trifluoromethoxy)phenyl]carbamate |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)OC1CCCNC1 |
| InChI | InChI=1S/C13H15F3N2O3/c14-13(15,16)21-10-5-3-9(4-6-10)18-12(19)20-11-2-1-7-17-8-11/h3-6,11,17H,1-2,7-8H2,(H,18,19) |
| InChIKey | VFMJJUJTIJSVRI-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |