C12H13F3N2O2 — CID 79337084
pyrrolidin-3-yl N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 79337084) has the molecular formula C12H13F3N2O2 and a molecular weight of 274.24 g/mol. Its IUPAC name is pyrrolidin-3-yl N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | pyrrolidin-3-yl N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 79337084 |
| Molecular Formula | C12H13F3N2O2 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | pyrrolidin-3-yl N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)OC1CCNC1 |
| InChI | InChI=1S/C12H13F3N2O2/c13-12(14,15)8-2-1-3-9(6-8)17-11(18)19-10-4-5-16-7-10/h1-3,6,10,16H,4-5,7H2,(H,17,18) |
| InChIKey | GBJFWKZCHNPPIA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |