C14H17F3N2O2 — CID 102954781
(4-methylpiperidin-3-yl) N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 102954781) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is (4-methylpiperidin-3-yl) N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | (4-methylpiperidin-3-yl) N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 102954781 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | (4-methylpiperidin-3-yl) N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC1CCNCC1OC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O2/c1-9-5-6-18-8-12(9)21-13(20)19-11-4-2-3-10(7-11)14(15,16)17/h2-4,7,9,12,18H,5-6,8H2,1H3,(H,19,20) |
| InChIKey | NXPRRYSLOXRROM-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |