C18H17ClF3NO2S — CID 7102046
[(2R,4S,4aS,8aR)-6-chloro-2-methyl-3,4,4a,8a-tetrahydro-2H-thiochromen-4-yl] N-[3-(trifluoromethyl)phenyl]carbamate (PubChem CID 7102046) has the molecular formula C18H17ClF3NO2S and a molecular weight of 403.85 g/mol. Its IUPAC name is [(2R,4S,4aS,8aR)-6-chloro-2-methyl-3,4,4a,8a-tetrahydro-2H-thiochromen-4-yl] N-[3-(trifluoromethyl)phenyl]carbamate.
| Compound Name | [(2R,4S,4aS,8aR)-6-chloro-2-methyl-3,4,4a,8a-tetrahydro-2H-thiochromen-4-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 7102046 |
| Molecular Formula | C18H17ClF3NO2S |
| Molecular Weight | 403.85 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | [(2R,4S,4aS,8aR)-6-chloro-2-methyl-3,4,4a,8a-tetrahydro-2H-thiochromen-4-yl] N-[3-(trifluoromethyl)phenyl]carbamate |
| SMILES | C[C@@H]1C[C@H](OC(=O)Nc2cccc(C(F)(F)F)c2)[C@@H]2C=C(Cl)C=C[C@H]2S1 |
| InChI | InChI=1S/C18H17ClF3NO2S/c1-10-7-15(14-9-12(19)5-6-16(14)26-10)25-17(24)23-13-4-2-3-11(8-13)18(20,21)22/h2-6,8-10,14-16H,7H2,1H3,(H,23,24)/t10-,14+,15+,16-/m1/s1 |
| InChIKey | PCCPROCGFPNVMC-GCUJQHFUSA-N |
| XLogP | 5.83 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.85 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |