C21H24F3N5O6 — CID 54575849
N-[(5S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-5-yl]-2-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]acetamide (PubChem CID 54575849) has the molecular formula C21H24F3N5O6 and a molecular weight of 499.45 g/mol. Its IUPAC name is N-[(5S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-5-yl]-2-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]acetamide.
| Compound Name | N-[(5S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-5-yl]-2-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 54575849 |
| Molecular Formula | C21H24F3N5O6 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | N-[(5S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-5-yl]-2-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(OCc2ccc(OC(F)(F)F)cc2)CC1)N[C@@H]1CCOc2nc([N+](=O)[O-])cn21 |
| InChI | InChI=1S/C21H24F3N5O6/c22-21(23,24)35-16-3-1-14(2-4-16)13-34-15-5-8-27(9-6-15)12-19(30)25-17-7-10-33-20-26-18(29(31)32)11-28(17)20/h1-4,11,15,17H,5-10,12-13H2,(H,25,30)/t17-/m0/s1 |
| InChIKey | QEGXWOSILPZJSS-KRWDZBQOSA-N |
| XLogP | 2.77 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|