C19H21F3N4O6 — CID 25209175
tert-butyl 2-nitro-6-[[4-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[1,2-a]pyrimidine-8-carboxylate (PubChem CID 25209175) has the molecular formula C19H21F3N4O6 and a molecular weight of 458.39 g/mol. Its IUPAC name is tert-butyl 2-nitro-6-[[4-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[1,2-a]pyrimidine-8-carboxylate.
| Compound Name | tert-butyl 2-nitro-6-[[4-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[1,2-a]pyrimidine-8-carboxylate |
|---|---|
| PubChem CID | 25209175 |
| Molecular Formula | C19H21F3N4O6 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | tert-butyl 2-nitro-6-[[4-(trifluoromethoxy)phenyl]methoxy]-6,7-dihydro-5H-imidazo[1,2-a]pyrimidine-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(OCc2ccc(OC(F)(F)F)cc2)Cn2cc([N+](=O)[O-])nc21 |
| InChI | InChI=1S/C19H21F3N4O6/c1-18(2,3)32-17(27)25-9-14(8-24-10-15(26(28)29)23-16(24)25)30-11-12-4-6-13(7-5-12)31-19(20,21)22/h4-7,10,14H,8-9,11H2,1-3H3 |
| InChIKey | RVFLLTWAHJXDIV-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 108.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|