C19H24F3NO6S — CID 142009718
4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfonyloxane-4-carbaldehyde (PubChem CID 142009718) has the molecular formula C19H24F3NO6S and a molecular weight of 451.46 g/mol. Its IUPAC name is 4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfonyloxane-4-carbaldehyde.
| Compound Name | 4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfonyloxane-4-carbaldehyde |
|---|---|
| PubChem CID | 142009718 |
| Molecular Formula | C19H24F3NO6S |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfonyloxane-4-carbaldehyde |
| SMILES | O=CC1(S(=O)(=O)N2CCC(OCc3ccc(OC(F)(F)F)cc3)CC2)CCOCC1 |
| InChI | InChI=1S/C19H24F3NO6S/c20-19(21,22)29-17-3-1-15(2-4-17)13-28-16-5-9-23(10-6-16)30(25,26)18(14-24)7-11-27-12-8-18/h1-4,14,16H,5-13H2 |
| InChIKey | ZMIRYRORQBGVRS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|