C25H37N3O5S — CID 142009642
N-hydroxy-4-[4-[1-(4-methoxybenzoyl)piperidin-4-yl]azepan-1-yl]sulfanyloxane-4-carboxamide (PubChem CID 142009642) has the molecular formula C25H37N3O5S and a molecular weight of 491.65 g/mol. Its IUPAC name is N-hydroxy-4-[4-[1-(4-methoxybenzoyl)piperidin-4-yl]azepan-1-yl]sulfanyloxane-4-carboxamide.
| Compound Name | N-hydroxy-4-[4-[1-(4-methoxybenzoyl)piperidin-4-yl]azepan-1-yl]sulfanyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142009642 |
| Molecular Formula | C25H37N3O5S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | N-hydroxy-4-[4-[1-(4-methoxybenzoyl)piperidin-4-yl]azepan-1-yl]sulfanyloxane-4-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCC(C3CCCN(SC4(C(=O)NO)CCOCC4)CC3)CC2)cc1 |
| InChI | InChI=1S/C25H37N3O5S/c1-32-22-6-4-21(5-7-22)23(29)27-14-8-20(9-15-27)19-3-2-13-28(16-10-19)34-25(24(30)26-31)11-17-33-18-12-25/h4-7,19-20,31H,2-3,8-18H2,1H3,(H,26,30) |
| InChIKey | XZJOKGWANBHKTA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|