C19H21NO6S — CID 110603906
3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethoxyphenyl)sulfonylpyrrolidine (PubChem CID 110603906) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethoxyphenyl)sulfonylpyrrolidine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethoxyphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 110603906 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethoxyphenyl)sulfonylpyrrolidine |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(c3ccc4c(c3)OCO4)C2)c(OC)c1 |
| InChI | InChI=1S/C19H21NO6S/c1-23-15-4-6-19(18(10-15)24-2)27(21,22)20-8-7-14(11-20)13-3-5-16-17(9-13)26-12-25-16/h3-6,9-10,14H,7-8,11-12H2,1-2H3 |
| InChIKey | MXLHMIRIAIVCIX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |