C19H21NO4S — CID 94919311
(3S)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethylphenyl)sulfonylpyrrolidine (PubChem CID 94919311) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is (3S)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethylphenyl)sulfonylpyrrolidine.
| Compound Name | (3S)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 94919311 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | (3S)-3-(1,3-benzodioxol-5-yl)-1-(2,4-dimethylphenyl)sulfonylpyrrolidine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@@H](c3ccc4c(c3)OCO4)C2)c(C)c1 |
| InChI | InChI=1S/C19H21NO4S/c1-13-3-6-19(14(2)9-13)25(21,22)20-8-7-16(11-20)15-4-5-17-18(10-15)24-12-23-17/h3-6,9-10,16H,7-8,11-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | UEPHIHXFAGRAOZ-MRXNPFEDSA-N |
| XLogP | 3.21 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |