C19H22N2O4S — CID 113079658
1-(1,3-benzodioxol-5-yl)-4-(2,4-dimethylphenyl)sulfonylpiperazine (PubChem CID 113079658) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-(2,4-dimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-(2,4-dimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 113079658 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-(2,4-dimethylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3ccc4c(c3)OCO4)CC2)c(C)c1 |
| InChI | InChI=1S/C19H22N2O4S/c1-14-3-6-19(15(2)11-14)26(22,23)21-9-7-20(8-10-21)16-4-5-17-18(12-16)25-13-24-17/h3-6,11-12H,7-10,13H2,1-2H3 |
| InChIKey | RNHICQZOZGZVAF-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|