C15H16N2O4S2 — CID 113079667
1-(1,3-benzodioxol-5-yl)-4-thiophen-2-ylsulfonylpiperazine (PubChem CID 113079667) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-4-thiophen-2-ylsulfonylpiperazine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-4-thiophen-2-ylsulfonylpiperazine |
|---|---|
| PubChem CID | 113079667 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-4-thiophen-2-ylsulfonylpiperazine |
| SMILES | O=S(=O)(c1cccs1)N1CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C15H16N2O4S2/c18-23(19,15-2-1-9-22-15)17-7-5-16(6-8-17)12-3-4-13-14(10-12)21-11-20-13/h1-4,9-10H,5-8,11H2 |
| InChIKey | ICXOXZAQTCVACK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|