C16H18N4O2S2 — CID 110643444
2-methyl-6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-1H-benzimidazole (PubChem CID 110643444) has the molecular formula C16H18N4O2S2 and a molecular weight of 362.48 g/mol. Its IUPAC name is 2-methyl-6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-1H-benzimidazole.
| Compound Name | 2-methyl-6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-1H-benzimidazole |
|---|---|
| PubChem CID | 110643444 |
| Molecular Formula | C16H18N4O2S2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 2-methyl-6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)-1H-benzimidazole |
| SMILES | Cc1nc2ccc(N3CCN(S(=O)(=O)c4cccs4)CC3)cc2[nH]1 |
| InChI | InChI=1S/C16H18N4O2S2/c1-12-17-14-5-4-13(11-15(14)18-12)19-6-8-20(9-7-19)24(21,22)16-3-2-10-23-16/h2-5,10-11H,6-9H2,1H3,(H,17,18) |
| InChIKey | PSOVVSLRKOVVSD-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |