C16H22N4O2S2 — CID 26539778
4-methyl-2-propan-2-yl-6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)pyrimidine (PubChem CID 26539778) has the molecular formula C16H22N4O2S2 and a molecular weight of 366.51 g/mol. Its IUPAC name is 4-methyl-2-propan-2-yl-6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)pyrimidine.
| Compound Name | 4-methyl-2-propan-2-yl-6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 26539778 |
| Molecular Formula | C16H22N4O2S2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-methyl-2-propan-2-yl-6-(4-thiophen-2-ylsulfonylpiperazin-1-yl)pyrimidine |
| SMILES | Cc1cc(N2CCN(S(=O)(=O)c3cccs3)CC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C16H22N4O2S2/c1-12(2)16-17-13(3)11-14(18-16)19-6-8-20(9-7-19)24(21,22)15-5-4-10-23-15/h4-5,10-12H,6-9H2,1-3H3 |
| InChIKey | QOWZOSHABZSNHP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |