C19H25ClN4O2S — CID 39626348
4-[4-(4-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-6-methyl-2-propan-2-ylpyrimidine (PubChem CID 39626348) has the molecular formula C19H25ClN4O2S and a molecular weight of 408.96 g/mol. Its IUPAC name is 4-[4-(4-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-6-methyl-2-propan-2-ylpyrimidine.
| Compound Name | 4-[4-(4-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-6-methyl-2-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 39626348 |
| Molecular Formula | C19H25ClN4O2S |
| Molecular Weight | 408.96 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 4-[4-(4-chloro-2-methylphenyl)sulfonylpiperazin-1-yl]-6-methyl-2-propan-2-ylpyrimidine |
| SMILES | Cc1cc(N2CCN(S(=O)(=O)c3ccc(Cl)cc3C)CC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C19H25ClN4O2S/c1-13(2)19-21-15(4)12-18(22-19)23-7-9-24(10-8-23)27(25,26)17-6-5-16(20)11-14(17)3/h5-6,11-13H,7-10H2,1-4H3 |
| InChIKey | ADPRSCDZBGDFBO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.96 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |