C16H21ClN4O2S2 — CID 26539789
4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-6-methyl-2-propan-2-ylpyrimidine (PubChem CID 26539789) has the molecular formula C16H21ClN4O2S2 and a molecular weight of 400.96 g/mol. Its IUPAC name is 4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-6-methyl-2-propan-2-ylpyrimidine.
| Compound Name | 4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-6-methyl-2-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 26539789 |
| Molecular Formula | C16H21ClN4O2S2 |
| Molecular Weight | 400.96 g/mol |
| Exact Mass | 400.08 |
| IUPAC Name | 4-[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]-6-methyl-2-propan-2-ylpyrimidine |
| SMILES | Cc1cc(N2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C16H21ClN4O2S2/c1-11(2)16-18-12(3)10-14(19-16)20-6-8-21(9-7-20)25(22,23)15-5-4-13(17)24-15/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | NQFJNOORAUVVNX-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.96 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |