C16H21N3O2S2 — CID 113078798
N,N-dimethyl-4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)aniline (PubChem CID 113078798) has the molecular formula C16H21N3O2S2 and a molecular weight of 351.50 g/mol. Its IUPAC name is N,N-dimethyl-4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)aniline.
| Compound Name | N,N-dimethyl-4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 113078798 |
| Molecular Formula | C16H21N3O2S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N,N-dimethyl-4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)aniline |
| SMILES | CN(C)c1ccc(N2CCN(S(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C16H21N3O2S2/c1-17(2)14-5-7-15(8-6-14)18-9-11-19(12-10-18)23(20,21)16-4-3-13-22-16/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | INPBDUIAUYYPGA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|