C17H22N2O4S2 — CID 70659611
(2S)-2-[4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenyl]propane-1,2-diol (PubChem CID 70659611) has the molecular formula C17H22N2O4S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is (2S)-2-[4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenyl]propane-1,2-diol.
| Compound Name | (2S)-2-[4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenyl]propane-1,2-diol |
|---|---|
| PubChem CID | 70659611 |
| Molecular Formula | C17H22N2O4S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (2S)-2-[4-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenyl]propane-1,2-diol |
| SMILES | C[C@@](O)(CO)c1ccc(N2CCN(S(=O)(=O)c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C17H22N2O4S2/c1-17(21,13-20)14-4-6-15(7-5-14)18-8-10-19(11-9-18)25(22,23)16-3-2-12-24-16/h2-7,12,20-21H,8-11,13H2,1H3/t17-/m1/s1 |
| InChIKey | WCJYQXLIVJMCCZ-QGZVFWFLSA-N |
| XLogP | 1.46 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|