C20H26N2O3S2 — CID 70659308
2-[4-[(3R)-3-cyclopropyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 70659308) has the molecular formula C20H26N2O3S2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 2-[4-[(3R)-3-cyclopropyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 2-[4-[(3R)-3-cyclopropyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 70659308 |
| Molecular Formula | C20H26N2O3S2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[4-[(3R)-3-cyclopropyl-4-thiophen-2-ylsulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | CC(C)(O)c1ccc(N2CCN(S(=O)(=O)c3cccs3)[C@H](C3CC3)C2)cc1 |
| InChI | InChI=1S/C20H26N2O3S2/c1-20(2,23)16-7-9-17(10-8-16)21-11-12-22(18(14-21)15-5-6-15)27(24,25)19-4-3-13-26-19/h3-4,7-10,13,15,18,23H,5-6,11-12,14H2,1-2H3/t18-/m0/s1 |
| InChIKey | ORTURMRLWHGDTD-SFHVURJKSA-N |
| XLogP | 3.27 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|