C16H18N2O5S2 — CID 139618989
2-[3-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenoxy]acetic acid (PubChem CID 139618989) has the molecular formula C16H18N2O5S2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-[3-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenoxy]acetic acid.
| Compound Name | 2-[3-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenoxy]acetic acid |
|---|---|
| PubChem CID | 139618989 |
| Molecular Formula | C16H18N2O5S2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-[3-(4-thiophen-2-ylsulfonylpiperazin-1-yl)phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(N2CCN(S(=O)(=O)c3cccs3)CC2)c1 |
| InChI | InChI=1S/C16H18N2O5S2/c19-15(20)12-23-14-4-1-3-13(11-14)17-6-8-18(9-7-17)25(21,22)16-5-2-10-24-16/h1-5,10-11H,6-9,12H2,(H,19,20) |
| InChIKey | NCVXKSPWWXDDRN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |