C16H17FN2O4S2 — CID 7750224
2-(4-fluorophenoxy)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethanone (PubChem CID 7750224) has the molecular formula C16H17FN2O4S2 and a molecular weight of 384.45 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethanone.
| Compound Name | 2-(4-fluorophenoxy)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 7750224 |
| Molecular Formula | C16H17FN2O4S2 |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | 2-(4-fluorophenoxy)-1-(4-thiophen-2-ylsulfonylpiperazin-1-yl)ethanone |
| SMILES | O=C(COc1ccc(F)cc1)N1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H17FN2O4S2/c17-13-3-5-14(6-4-13)23-12-15(20)18-7-9-19(10-8-18)25(21,22)16-2-1-11-24-16/h1-6,11H,7-10,12H2 |
| InChIKey | OYSBYVQDVFHRGD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |