C20H24N2O4S — CID 110363952
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2,4-dimethylphenyl)sulfonylpiperazine (PubChem CID 110363952) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2,4-dimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2,4-dimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 110363952 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2,4-dimethylphenyl)sulfonylpiperazine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(c3ccc4c(c3)OCCO4)CC2)c(C)c1 |
| InChI | InChI=1S/C20H24N2O4S/c1-15-3-6-20(16(2)13-15)27(23,24)22-9-7-21(8-10-22)17-4-5-18-19(14-17)26-12-11-25-18/h3-6,13-14H,7-12H2,1-2H3 |
| InChIKey | HGQDZZDQTBLXFX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|