C20H18F3N3O3S2 — CID 142028030
N-hydroxy-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanyl-1,3-benzothiazole-7-carboxamide (PubChem CID 142028030) has the molecular formula C20H18F3N3O3S2 and a molecular weight of 469.51 g/mol. Its IUPAC name is N-hydroxy-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanyl-1,3-benzothiazole-7-carboxamide.
| Compound Name | N-hydroxy-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanyl-1,3-benzothiazole-7-carboxamide |
|---|---|
| PubChem CID | 142028030 |
| Molecular Formula | C20H18F3N3O3S2 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.07 |
| IUPAC Name | N-hydroxy-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanyl-1,3-benzothiazole-7-carboxamide |
| SMILES | O=C(NO)c1c(SN2CCC(Oc3ccc(C(F)(F)F)cc3)CC2)ccc2ncsc12 |
| InChI | InChI=1S/C20H18F3N3O3S2/c21-20(22,23)12-1-3-13(4-2-12)29-14-7-9-26(10-8-14)31-16-6-5-15-18(30-11-24-15)17(16)19(27)25-28/h1-6,11,14,28H,7-10H2,(H,25,27) |
| InChIKey | OKHRYQQTSQXBFF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|