C23H22F3N3O6 — CID 142206842
6-[2,3-dioxo-1-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]propyl]-N-hydroxy-2,3-dihydro-1,3-benzoxazole-7-carboxamide (PubChem CID 142206842) has the molecular formula C23H22F3N3O6 and a molecular weight of 493.44 g/mol. Its IUPAC name is 6-[2,3-dioxo-1-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]propyl]-N-hydroxy-2,3-dihydro-1,3-benzoxazole-7-carboxamide.
| Compound Name | 6-[2,3-dioxo-1-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]propyl]-N-hydroxy-2,3-dihydro-1,3-benzoxazole-7-carboxamide |
|---|---|
| PubChem CID | 142206842 |
| Molecular Formula | C23H22F3N3O6 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 6-[2,3-dioxo-1-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]propyl]-N-hydroxy-2,3-dihydro-1,3-benzoxazole-7-carboxamide |
| SMILES | O=CC(=O)C(c1ccc2c(c1C(=O)NO)OCN2)N1CCC(Oc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H22F3N3O6/c24-23(25,26)13-1-3-14(4-2-13)35-15-7-9-29(10-8-15)20(18(31)11-30)16-5-6-17-21(34-12-27-17)19(16)22(32)28-33/h1-6,11,15,20,27,33H,7-10,12H2,(H,28,32) |
| InChIKey | CTBWUXXNKHVHML-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|