C21H23F3N2O5S — CID 142028119
N-hydroxy-2,3-dimethoxy-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylbenzamide (PubChem CID 142028119) has the molecular formula C21H23F3N2O5S and a molecular weight of 472.49 g/mol. Its IUPAC name is N-hydroxy-2,3-dimethoxy-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylbenzamide.
| Compound Name | N-hydroxy-2,3-dimethoxy-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylbenzamide |
|---|---|
| PubChem CID | 142028119 |
| Molecular Formula | C21H23F3N2O5S |
| Molecular Weight | 472.49 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | N-hydroxy-2,3-dimethoxy-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylbenzamide |
| SMILES | COc1ccc(SN2CCC(Oc3ccc(C(F)(F)F)cc3)CC2)c(C(=O)NO)c1OC |
| InChI | InChI=1S/C21H23F3N2O5S/c1-29-16-7-8-17(18(19(16)30-2)20(27)25-28)32-26-11-9-15(10-12-26)31-14-5-3-13(4-6-14)21(22,23)24/h3-8,15,28H,9-12H2,1-2H3,(H,25,27) |
| InChIKey | YPZDNCHZQQZIPP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|