C21H22F3NO3S — CID 167117230
3-[4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylphenyl]oxetan-3-ol (PubChem CID 167117230) has the molecular formula C21H22F3NO3S and a molecular weight of 425.47 g/mol. Its IUPAC name is 3-[4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylphenyl]oxetan-3-ol.
| Compound Name | 3-[4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylphenyl]oxetan-3-ol |
|---|---|
| PubChem CID | 167117230 |
| Molecular Formula | C21H22F3NO3S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 3-[4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylphenyl]oxetan-3-ol |
| SMILES | OC1(c2ccc(SN3CCC(Oc4ccc(C(F)(F)F)cc4)CC3)cc2)COC1 |
| InChI | InChI=1S/C21H22F3NO3S/c22-21(23,24)16-1-5-17(6-2-16)28-18-9-11-25(12-10-18)29-19-7-3-15(4-8-19)20(26)13-27-14-20/h1-8,18,26H,9-14H2 |
| InChIKey | HFXKPPNDOCKQDI-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|