C23H24F3NO4 — CID 164533270
4-(3-hydroxyoxetan-3-yl)-N-[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]benzamide (PubChem CID 164533270) has the molecular formula C23H24F3NO4 and a molecular weight of 435.44 g/mol. Its IUPAC name is 4-(3-hydroxyoxetan-3-yl)-N-[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]benzamide.
| Compound Name | 4-(3-hydroxyoxetan-3-yl)-N-[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]benzamide |
|---|---|
| PubChem CID | 164533270 |
| Molecular Formula | C23H24F3NO4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 4-(3-hydroxyoxetan-3-yl)-N-[4-[4-(trifluoromethyl)phenoxy]cyclohexyl]benzamide |
| SMILES | O=C(NC1CCC(Oc2ccc(C(F)(F)F)cc2)CC1)c1ccc(C2(O)COC2)cc1 |
| InChI | InChI=1S/C23H24F3NO4/c24-23(25,26)17-5-9-19(10-6-17)31-20-11-7-18(8-12-20)27-21(28)15-1-3-16(4-2-15)22(29)13-30-14-22/h1-6,9-10,18,20,29H,7-8,11-14H2,(H,27,28) |
| InChIKey | BBOLHXPRDAVDHT-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |