C22H21ClF3NO4 — CID 164533293
[3-chloro-4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]-[4-(3-hydroxyoxetan-3-yl)phenyl]methanone (PubChem CID 164533293) has the molecular formula C22H21ClF3NO4 and a molecular weight of 455.86 g/mol. Its IUPAC name is [3-chloro-4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]-[4-(3-hydroxyoxetan-3-yl)phenyl]methanone.
| Compound Name | [3-chloro-4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]-[4-(3-hydroxyoxetan-3-yl)phenyl]methanone |
|---|---|
| PubChem CID | 164533293 |
| Molecular Formula | C22H21ClF3NO4 |
| Molecular Weight | 455.86 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [3-chloro-4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]-[4-(3-hydroxyoxetan-3-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(C2(O)COC2)cc1)N1CCC(Oc2ccc(C(F)(F)F)cc2)C(Cl)C1 |
| InChI | InChI=1S/C22H21ClF3NO4/c23-18-11-27(20(28)14-1-3-15(4-2-14)21(29)12-30-13-21)10-9-19(18)31-17-7-5-16(6-8-17)22(24,25)26/h1-8,18-19,29H,9-13H2 |
| InChIKey | HEHUSTZQSHWMIW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.86 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|