C22H23F3N2O3 — CID 164533483
[4-(3-hydroxyoxetan-3-yl)phenyl]-[4-[4-(trifluoromethyl)anilino]piperidin-1-yl]methanone (PubChem CID 164533483) has the molecular formula C22H23F3N2O3 and a molecular weight of 420.43 g/mol. Its IUPAC name is [4-(3-hydroxyoxetan-3-yl)phenyl]-[4-[4-(trifluoromethyl)anilino]piperidin-1-yl]methanone.
| Compound Name | [4-(3-hydroxyoxetan-3-yl)phenyl]-[4-[4-(trifluoromethyl)anilino]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 164533483 |
| Molecular Formula | C22H23F3N2O3 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | [4-(3-hydroxyoxetan-3-yl)phenyl]-[4-[4-(trifluoromethyl)anilino]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(C2(O)COC2)cc1)N1CCC(Nc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H23F3N2O3/c23-22(24,25)17-5-7-18(8-6-17)26-19-9-11-27(12-10-19)20(28)15-1-3-16(4-2-15)21(29)13-30-14-21/h1-8,19,26,29H,9-14H2 |
| InChIKey | CDVHWMSVTDXLSU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |