C22H22F3NO4 — CID 164533378
[4-(3-hydroxyoxetan-3-yl)phenyl]-[3-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone (PubChem CID 164533378) has the molecular formula C22H22F3NO4 and a molecular weight of 421.42 g/mol. Its IUPAC name is [4-(3-hydroxyoxetan-3-yl)phenyl]-[3-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone.
| Compound Name | [4-(3-hydroxyoxetan-3-yl)phenyl]-[3-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 164533378 |
| Molecular Formula | C22H22F3NO4 |
| Molecular Weight | 421.42 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [4-(3-hydroxyoxetan-3-yl)phenyl]-[3-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(C2(O)COC2)cc1)N1CCCC(Oc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C22H22F3NO4/c23-22(24,25)17-7-9-18(10-8-17)30-19-2-1-11-26(12-19)20(27)15-3-5-16(6-4-15)21(28)13-29-14-21/h3-10,19,28H,1-2,11-14H2 |
| InChIKey | RHVJYHJHGDXSES-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |