C25H28F3NO6 — CID 164533322
[4-(3-hydroxyoxetan-3-yl)-3-(2-methoxyethoxy)phenyl]-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone (PubChem CID 164533322) has the molecular formula C25H28F3NO6 and a molecular weight of 495.49 g/mol. Its IUPAC name is [4-(3-hydroxyoxetan-3-yl)-3-(2-methoxyethoxy)phenyl]-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone.
| Compound Name | [4-(3-hydroxyoxetan-3-yl)-3-(2-methoxyethoxy)phenyl]-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 164533322 |
| Molecular Formula | C25H28F3NO6 |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.19 |
| IUPAC Name | [4-(3-hydroxyoxetan-3-yl)-3-(2-methoxyethoxy)phenyl]-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]methanone |
| SMILES | COCCOc1cc(C(=O)N2CCC(Oc3ccc(C(F)(F)F)cc3)CC2)ccc1C1(O)COC1 |
| InChI | InChI=1S/C25H28F3NO6/c1-32-12-13-34-22-14-17(2-7-21(22)24(31)15-33-16-24)23(30)29-10-8-20(9-11-29)35-19-5-3-18(4-6-19)25(26,27)28/h2-7,14,20,31H,8-13,15-16H2,1H3 |
| InChIKey | SPUJRGFUOKGLOZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|