C16H21NO4 — CID 136582746
N-(3-hydroxycyclobutyl)-4-(oxan-4-yloxy)benzamide (PubChem CID 136582746) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-(3-hydroxycyclobutyl)-4-(oxan-4-yloxy)benzamide.
| Compound Name | N-(3-hydroxycyclobutyl)-4-(oxan-4-yloxy)benzamide |
|---|---|
| PubChem CID | 136582746 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | N-(3-hydroxycyclobutyl)-4-(oxan-4-yloxy)benzamide |
| SMILES | O=C(NC1CC(O)C1)c1ccc(OC2CCOCC2)cc1 |
| InChI | InChI=1S/C16H21NO4/c18-13-9-12(10-13)17-16(19)11-1-3-14(4-2-11)21-15-5-7-20-8-6-15/h1-4,12-13,15,18H,5-10H2,(H,17,19) |
| InChIKey | WCCQGYNUUXMMJL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |