C18H19Cl2F3N2O3S2 — CID 142028058
2-chloro-N-hydroxy-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylthiophene-3-carboxamide;chloromethane (PubChem CID 142028058) has the molecular formula C18H19Cl2F3N2O3S2 and a molecular weight of 503.40 g/mol. Its IUPAC name is 2-chloro-N-hydroxy-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylthiophene-3-carboxamide;chloromethane.
| Compound Name | 2-chloro-N-hydroxy-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylthiophene-3-carboxamide;chloromethane |
|---|---|
| PubChem CID | 142028058 |
| Molecular Formula | C18H19Cl2F3N2O3S2 |
| Molecular Weight | 503.40 g/mol |
| Exact Mass | 502.02 |
| IUPAC Name | 2-chloro-N-hydroxy-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfanylthiophene-3-carboxamide;chloromethane |
| SMILES | CCl.O=C(NO)c1c(SN2CCC(Oc3ccc(C(F)(F)F)cc3)CC2)csc1Cl |
| InChI | InChI=1S/C17H16ClF3N2O3S2.CH3Cl/c18-15-14(16(24)22-25)13(9-27-15)28-23-7-5-12(6-8-23)26-11-3-1-10(2-4-11)17(19,20)21;1-2/h1-4,9,12,25H,5-8H2,(H,22,24);1H3 |
| InChIKey | QFDVQEPNPGRZOZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.40 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|