C27H27F3N2O6S — CID 142028150
N-hydroxy-2,3-dimethoxy-6-[4-[4-[3-(trifluoromethyl)phenyl]phenoxy]piperidin-1-yl]sulfinylbenzamide (PubChem CID 142028150) has the molecular formula C27H27F3N2O6S and a molecular weight of 564.58 g/mol. Its IUPAC name is N-hydroxy-2,3-dimethoxy-6-[4-[4-[3-(trifluoromethyl)phenyl]phenoxy]piperidin-1-yl]sulfinylbenzamide.
| Compound Name | N-hydroxy-2,3-dimethoxy-6-[4-[4-[3-(trifluoromethyl)phenyl]phenoxy]piperidin-1-yl]sulfinylbenzamide |
|---|---|
| PubChem CID | 142028150 |
| Molecular Formula | C27H27F3N2O6S |
| Molecular Weight | 564.58 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | N-hydroxy-2,3-dimethoxy-6-[4-[4-[3-(trifluoromethyl)phenyl]phenoxy]piperidin-1-yl]sulfinylbenzamide |
| SMILES | COc1ccc(S(=O)N2CCC(Oc3ccc(-c4cccc(C(F)(F)F)c4)cc3)CC2)c(C(=O)NO)c1OC |
| InChI | InChI=1S/C27H27F3N2O6S/c1-36-22-10-11-23(24(25(22)37-2)26(33)31-34)39(35)32-14-12-21(13-15-32)38-20-8-6-17(7-9-20)18-4-3-5-19(16-18)27(28,29)30/h3-11,16,21,34H,12-15H2,1-2H3,(H,31,33) |
| InChIKey | OJAFIQBFGJEMMV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.58 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|